C12H17NO — CID 121015503
1-ethyl-2,5-dimethyl-6,7-dihydro-5H-indol-4-one (PubChem CID 121015503) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-ethyl-2,5-dimethyl-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-ethyl-2,5-dimethyl-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 121015503 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-ethyl-2,5-dimethyl-6,7-dihydro-5H-indol-4-one |
| SMILES | CCn1c(C)cc2c1CCC(C)C2=O |
| InChI | InChI=1S/C12H17NO/c1-4-13-9(3)7-10-11(13)6-5-8(2)12(10)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | HFUAIKHUUUIHEI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |