C12H25NO2 — CID 177191793
ethane;1-ethyl-3-methylpiperidine-2,6-dione (PubChem CID 177191793) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylpiperidine-2,6-dione.
| Compound Name | ethane;1-ethyl-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 177191793 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;1-ethyl-3-methylpiperidine-2,6-dione |
| SMILES | CC.CC.CCN1C(=O)CCC(C)C1=O |
| InChI | InChI=1S/C8H13NO2.2C2H6/c1-3-9-7(10)5-4-6(2)8(9)11;2*1-2/h6H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | UPCGZLJNRGZROB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|