About (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide
(3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide (PubChem CID 146401292) has the molecular formula C6H11BrN2O2
and a molecular weight of 223.07 g/mol. Its IUPAC name is (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide.
Molecular Properties
| Compound Name | (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide |
| PubChem CID | 146401292 |
| Molecular Formula | C6H11BrN2O2 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide |
| SMILES | Br.CN1C(=O)CC[C@@H](N)C1=O |
| InChI | InChI=1S/C6H10N2O2.BrH/c1-8-5(9)3-2-4(7)6(8)10;/h4H,2-3,7H2,1H3;1H/t4-;/m1./s1 |
| InChIKey | FGIQNTBHOUONOK-PGMHMLKASA-N |
| XLogP | -0.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide?
The IUPAC name of (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide (CID 146401292) is (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide.
What is the SMILES notation for (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide?
The canonical SMILES for (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide is Br.CN1C(=O)CC[C@@H](N)C1=O.
What is the InChIKey of (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide?
The InChIKey is FGIQNTBHOUONOK-PGMHMLKASA-N. The full InChI is InChI=1S/C6H10N2O2.BrH/c1-8-5(9)3-2-4(7)6(8)10;/h4H,2-3,7H2,1H3;1H/t4-;/m1./s1.
What are the key properties of (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide?
(3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide has a molecular weight of 223.07 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-1-methylpiperidine-2,6-dione;hydrobromide is sourced from PubChem (CID 146401292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).