C9H16N4O — CID 130341288
3,6-diamino-1-methyl-7-(methyliminomethyl)-4,5-dihydro-3H-azepin-2-one (PubChem CID 130341288) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,6-diamino-1-methyl-7-(methyliminomethyl)-4,5-dihydro-3H-azepin-2-one.
| Compound Name | 3,6-diamino-1-methyl-7-(methyliminomethyl)-4,5-dihydro-3H-azepin-2-one |
|---|---|
| PubChem CID | 130341288 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3,6-diamino-1-methyl-7-(methyliminomethyl)-4,5-dihydro-3H-azepin-2-one |
| SMILES | C/N=C/C1=C(N)CCC(N)C(=O)N1C |
| InChI | InChI=1S/C9H16N4O/c1-12-5-8-6(10)3-4-7(11)9(14)13(8)2/h5,7H,3-4,10-11H2,1-2H3/b12-5+ |
| InChIKey | BXDRECFIHHBZQD-LFYBBSHMSA-N |
| XLogP | -0.56 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|