2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid

C10H17N3O4 — CID 18463926

IUPAC2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid
SMILESCCCN1C(=O)CCC(N)C(=O)N1CC(=O)O
InChIInChI=1S/C10H17N3O4/c1-2-5-12-8(14)4-3-7(11)10(17)13(12)6-9(15)16/h7H,2-6,11H2,1H3,(H,15,16)
InChIKeyLVLHYFYOANQPIZ-UHFFFAOYSA-N
MW243.26 g/mol
LogP-0.83
Rot. Bonds4

About 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid

2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid (PubChem CID 18463926) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid
PubChem CID18463926
Molecular FormulaC10H17N3O4
Molecular Weight243.26 g/mol
Exact Mass243.12
IUPAC Name2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid
SMILESCCCN1C(=O)CCC(N)C(=O)N1CC(=O)O
InChIInChI=1S/C10H17N3O4/c1-2-5-12-8(14)4-3-7(11)10(17)13(12)6-9(15)16/h7H,2-6,11H2,1H3,(H,15,16)
InChIKeyLVLHYFYOANQPIZ-UHFFFAOYSA-N
XLogP-0.83
TPSA103.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.26
LogP ≤ 5-0.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid?
The IUPAC name of 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid (CID 18463926) is 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid?
The canonical SMILES for 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid is CCCN1C(=O)CCC(N)C(=O)N1CC(=O)O.
What is the InChIKey of 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid?
The InChIKey is LVLHYFYOANQPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4/c1-2-5-12-8(14)4-3-7(11)10(17)13(12)6-9(15)16/h7H,2-6,11H2,1H3,(H,15,16).
What are the key properties of 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid?
2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid has a molecular weight of 243.26 g/mol, XLogP of -0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-3,7-dioxo-2-propyldiazepan-1-yl)acetic acid is sourced from PubChem (CID 18463926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).