C10H18N2O3 — CID 106456413
3-amino-1-(2-propoxyethyl)piperidine-2,6-dione (PubChem CID 106456413) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-amino-1-(2-propoxyethyl)piperidine-2,6-dione.
| Compound Name | 3-amino-1-(2-propoxyethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 106456413 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 3-amino-1-(2-propoxyethyl)piperidine-2,6-dione |
| SMILES | CCCOCCN1C(=O)CCC(N)C1=O |
| InChI | InChI=1S/C10H18N2O3/c1-2-6-15-7-5-12-9(13)4-3-8(11)10(12)14/h8H,2-7,11H2,1H3 |
| InChIKey | CEDONHHEBPUOQD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|