C9H14O — CID 45140128
5-ethyl-2,3-dimethylcyclopent-2-en-1-one (PubChem CID 45140128) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethylcyclopent-2-en-1-one.
| Compound Name | 5-ethyl-2,3-dimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 45140128 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 5-ethyl-2,3-dimethylcyclopent-2-en-1-one |
| SMILES | CCC1CC(C)=C(C)C1=O |
| InChI | InChI=1S/C9H14O/c1-4-8-5-6(2)7(3)9(8)10/h8H,4-5H2,1-3H3 |
| InChIKey | ZJYOILLIITYIGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |