C12H20O2 — CID 146741917
5-tert-butyl-3-ethylcyclohexane-1,2-dione (PubChem CID 146741917) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-tert-butyl-3-ethylcyclohexane-1,2-dione.
| Compound Name | 5-tert-butyl-3-ethylcyclohexane-1,2-dione |
|---|---|
| PubChem CID | 146741917 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5-tert-butyl-3-ethylcyclohexane-1,2-dione |
| SMILES | CCC1CC(C(C)(C)C)CC(=O)C1=O |
| InChI | InChI=1S/C12H20O2/c1-5-8-6-9(12(2,3)4)7-10(13)11(8)14/h8-9H,5-7H2,1-4H3 |
| InChIKey | HKMOHLITRNGCNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|