C14H22 — CID 143655758
8-butyl-1,2,3,7,8,8a-hexahydronaphthalene (PubChem CID 143655758) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 8-butyl-1,2,3,7,8,8a-hexahydronaphthalene.
| Compound Name | 8-butyl-1,2,3,7,8,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 143655758 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 8-butyl-1,2,3,7,8,8a-hexahydronaphthalene |
| SMILES | CCCCC1CC=CC2=CCCCC21 |
| InChI | InChI=1S/C14H22/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h6,8,10,12,14H,2-5,7,9,11H2,1H3 |
| InChIKey | XTHJGTSSBRXQSG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |