C19H28O4 — CID 143394764
3-acetyloxy-7-(1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid (PubChem CID 143394764) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-acetyloxy-7-(1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid.
| Compound Name | 3-acetyloxy-7-(1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 143394764 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-acetyloxy-7-(1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid |
| SMILES | CC(=O)OC(CCCCC1CC=CC2=CCCCC21)CC(=O)O |
| InChI | InChI=1S/C19H28O4/c1-14(20)23-17(13-19(21)22)11-4-2-7-15-9-6-10-16-8-3-5-12-18(15)16/h6,8,10,15,17-18H,2-5,7,9,11-13H2,1H3,(H,21,22) |
| InChIKey | RSLKTVCGRIHTNO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|