C16H18O — CID 102497508
(2S,3R,3aR)-2-methyl-3-phenyl-2,3,3a,4,5,6-hexahydroinden-1-one (PubChem CID 102497508) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S,3R,3aR)-2-methyl-3-phenyl-2,3,3a,4,5,6-hexahydroinden-1-one.
| Compound Name | (2S,3R,3aR)-2-methyl-3-phenyl-2,3,3a,4,5,6-hexahydroinden-1-one |
|---|---|
| PubChem CID | 102497508 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (2S,3R,3aR)-2-methyl-3-phenyl-2,3,3a,4,5,6-hexahydroinden-1-one |
| SMILES | C[C@@H]1C(=O)C2=CCCC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-11-15(12-7-3-2-4-8-12)13-9-5-6-10-14(13)16(11)17/h2-4,7-8,10-11,13,15H,5-6,9H2,1H3/t11-,13-,15+/m0/s1 |
| InChIKey | UGYABVVCNLLNAT-CORIIIEPSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |