C15H14O2 — CID 171384673
2-phenyl-3a,4,5,6-tetrahydroindene-1,3-dione (PubChem CID 171384673) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-phenyl-3a,4,5,6-tetrahydroindene-1,3-dione.
| Compound Name | 2-phenyl-3a,4,5,6-tetrahydroindene-1,3-dione |
|---|---|
| PubChem CID | 171384673 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-phenyl-3a,4,5,6-tetrahydroindene-1,3-dione |
| SMILES | O=C1C2=CCCCC2C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C15H14O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-3,6-8,12-13H,4-5,9H2 |
| InChIKey | LNBRVPMTZGHBRN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|