C13H13NO — CID 152763997
3,4,4a,5-tetrahydro-2H-phenanthridin-6-one (PubChem CID 152763997) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-phenanthridin-6-one.
| Compound Name | 3,4,4a,5-tetrahydro-2H-phenanthridin-6-one |
|---|---|
| PubChem CID | 152763997 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-phenanthridin-6-one |
| SMILES | O=C1NC2CCCC=C2c2ccccc21 |
| InChI | InChI=1S/C13H13NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-2,5-7,12H,3-4,8H2,(H,14,15) |
| InChIKey | FPLPPTZXNXDEPW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |