C13H13NO4 — CID 102382174
(2R,3R,4R,4aS)-2,3,4-trihydroxy-3,4,4a,5-tetrahydro-2H-phenanthridin-6-one (PubChem CID 102382174) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2R,3R,4R,4aS)-2,3,4-trihydroxy-3,4,4a,5-tetrahydro-2H-phenanthridin-6-one.
| Compound Name | (2R,3R,4R,4aS)-2,3,4-trihydroxy-3,4,4a,5-tetrahydro-2H-phenanthridin-6-one |
|---|---|
| PubChem CID | 102382174 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2R,3R,4R,4aS)-2,3,4-trihydroxy-3,4,4a,5-tetrahydro-2H-phenanthridin-6-one |
| SMILES | O=C1N[C@H]2C(=C[C@@H](O)[C@@H](O)[C@@H]2O)c2ccccc21 |
| InChI | InChI=1S/C13H13NO4/c15-9-5-8-6-3-1-2-4-7(6)13(18)14-10(8)12(17)11(9)16/h1-5,9-12,15-17H,(H,14,18)/t9-,10+,11-,12-/m1/s1 |
| InChIKey | LNVPOLSYAQYCSC-WRWGMCAJSA-N |
| XLogP | -0.72 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |