C20H34O — CID 170552728
2-cyclopentyl-2,3,3,4,4,4a-hexamethyl-6,7-dihydro-5H-chromene (PubChem CID 170552728) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 2-cyclopentyl-2,3,3,4,4,4a-hexamethyl-6,7-dihydro-5H-chromene.
| Compound Name | 2-cyclopentyl-2,3,3,4,4,4a-hexamethyl-6,7-dihydro-5H-chromene |
|---|---|
| PubChem CID | 170552728 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2-cyclopentyl-2,3,3,4,4,4a-hexamethyl-6,7-dihydro-5H-chromene |
| SMILES | CC12CCCC=C1OC(C)(C1CCCC1)C(C)(C)C2(C)C |
| InChI | InChI=1S/C20H34O/c1-17(2)18(3,4)20(6,15-11-7-8-12-15)21-16-13-9-10-14-19(16,17)5/h13,15H,7-12,14H2,1-6H3 |
| InChIKey | IYOSPQHWIWBYRZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |