About 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one
9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one (PubChem CID 71413496) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one.
Molecular Properties
| Compound Name | 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one |
| PubChem CID | 71413496 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one |
| SMILES | CC12CCC3CCCCC3(O1)C(=O)O2 |
| InChI | InChI=1S/C11H16O3/c1-10-7-5-8-4-2-3-6-11(8,14-10)9(12)13-10/h8H,2-7H2,1H3 |
| InChIKey | DOMUNMTYMDDRGO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one?
The IUPAC name of 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one (CID 71413496) is 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one.
What is the SMILES notation for 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one?
The canonical SMILES for 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one is CC12CCC3CCCCC3(O1)C(=O)O2.
What is the InChIKey of 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one?
The InChIKey is DOMUNMTYMDDRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-10-7-5-8-4-2-3-6-11(8,14-10)9(12)13-10/h8H,2-7H2,1H3.
What are the key properties of 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one?
9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one has a molecular weight of 196.25 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-10,12-dioxatricyclo[7.2.1.01,6]dodecan-11-one is sourced from PubChem (CID 71413496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).