C18H24O4 — CID 134873151
(6Z,17Z)-8,19-dioxatricyclo[16.2.0.07,10]icosa-6,17-diene-9,20-dione (PubChem CID 134873151) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (6Z,17Z)-8,19-dioxatricyclo[16.2.0.07,10]icosa-6,17-diene-9,20-dione.
| Compound Name | (6Z,17Z)-8,19-dioxatricyclo[16.2.0.07,10]icosa-6,17-diene-9,20-dione |
|---|---|
| PubChem CID | 134873151 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (6Z,17Z)-8,19-dioxatricyclo[16.2.0.07,10]icosa-6,17-diene-9,20-dione |
| SMILES | O=C1O/C2=C\CCCCCCC3C(=O)O/C3=C\CCCCC12 |
| InChI | InChI=1S/C18H24O4/c19-17-13-9-5-2-1-3-7-11-15-14(18(20)21-15)10-6-4-8-12-16(13)22-17/h11-14H,1-10H2/b15-11-,16-12- |
| InChIKey | IHTAYXADXGCFQD-NFLUSIDLSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|