C14H16O4 — CID 164598024
3-hydroxy-6a,7,8,9-tetrahydrobenzo[c]chromen-6-one;methanol (PubChem CID 164598024) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-hydroxy-6a,7,8,9-tetrahydrobenzo[c]chromen-6-one;methanol.
| Compound Name | 3-hydroxy-6a,7,8,9-tetrahydrobenzo[c]chromen-6-one;methanol |
|---|---|
| PubChem CID | 164598024 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-hydroxy-6a,7,8,9-tetrahydrobenzo[c]chromen-6-one;methanol |
| SMILES | CO.O=C1Oc2cc(O)ccc2C2=CCCCC12 |
| InChI | InChI=1S/C13H12O3.CH4O/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)16-12(10)7-8;1-2/h3,5-7,11,14H,1-2,4H2;2H,1H3 |
| InChIKey | FUBFUBKYJJUHPV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|