C12H13NO — CID 67863746
5,6,7,9-tetrahydro-4bH-carbazol-3-ol (PubChem CID 67863746) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 5,6,7,9-tetrahydro-4bH-carbazol-3-ol.
| Compound Name | 5,6,7,9-tetrahydro-4bH-carbazol-3-ol |
|---|---|
| PubChem CID | 67863746 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5,6,7,9-tetrahydro-4bH-carbazol-3-ol |
| SMILES | Oc1ccc2c(c1)C1CCCC=C1N2 |
| InChI | InChI=1S/C12H13NO/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h4-7,9,13-14H,1-3H2 |
| InChIKey | KOGMYYDAEYUDEV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|