C16H22N2O2 — CID 930010
(4bR,8aR)-8a-morpholin-4-yl-4b,5,6,7,8,9-hexahydrocarbazol-3-ol (PubChem CID 930010) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4bR,8aR)-8a-morpholin-4-yl-4b,5,6,7,8,9-hexahydrocarbazol-3-ol.
| Compound Name | (4bR,8aR)-8a-morpholin-4-yl-4b,5,6,7,8,9-hexahydrocarbazol-3-ol |
|---|---|
| PubChem CID | 930010 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (4bR,8aR)-8a-morpholin-4-yl-4b,5,6,7,8,9-hexahydrocarbazol-3-ol |
| SMILES | Oc1ccc2c(c1)[C@H]1CCCC[C@]1(N1CCOCC1)N2 |
| InChI | InChI=1S/C16H22N2O2/c19-12-4-5-15-13(11-12)14-3-1-2-6-16(14,17-15)18-7-9-20-10-8-18/h4-5,11,14,17,19H,1-3,6-10H2/t14-,16-/m1/s1 |
| InChIKey | UZZKWAMKOZSOMS-GDBMZVCRSA-N |
| XLogP | 2.50 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|