C12H12O — CID 71325377
4b,5,6,7-tetrahydrobiphenylen-2-ol (PubChem CID 71325377) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 4b,5,6,7-tetrahydrobiphenylen-2-ol.
| Compound Name | 4b,5,6,7-tetrahydrobiphenylen-2-ol |
|---|---|
| PubChem CID | 71325377 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 4b,5,6,7-tetrahydrobiphenylen-2-ol |
| SMILES | Oc1ccc2c(c1)C1=CCCCC12 |
| InChI | InChI=1S/C12H12O/c13-8-5-6-11-9-3-1-2-4-10(9)12(11)7-8/h4-7,9,13H,1-3H2 |
| InChIKey | HNDIATSIADVWPD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |