C11H13NO — CID 163433999
8-amino-5-methyl-5,6-dihydronaphthalen-2-ol (PubChem CID 163433999) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 8-amino-5-methyl-5,6-dihydronaphthalen-2-ol.
| Compound Name | 8-amino-5-methyl-5,6-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163433999 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 8-amino-5-methyl-5,6-dihydronaphthalen-2-ol |
| SMILES | CC1CC=C(N)c2cc(O)ccc21 |
| InChI | InChI=1S/C11H13NO/c1-7-2-5-11(12)10-6-8(13)3-4-9(7)10/h3-7,13H,2,12H2,1H3 |
| InChIKey | ASXKYMIXZXIAOO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |