C12H12BrN2O+ — CID 10923910
3-bromo-6-hydroxy-9-methyl-8,9-dihydro-7H-benzo[7]annulene-5-diazonium (PubChem CID 10923910) has the molecular formula C12H12BrN2O+ and a molecular weight of 280.14 g/mol. Its IUPAC name is 3-bromo-6-hydroxy-9-methyl-8,9-dihydro-7H-benzo[7]annulene-5-diazonium.
| Compound Name | 3-bromo-6-hydroxy-9-methyl-8,9-dihydro-7H-benzo[7]annulene-5-diazonium |
|---|---|
| PubChem CID | 10923910 |
| Molecular Formula | C12H12BrN2O+ |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 3-bromo-6-hydroxy-9-methyl-8,9-dihydro-7H-benzo[7]annulene-5-diazonium |
| SMILES | CC1CCC(O)=C([N+]#N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H11BrN2O/c1-7-2-5-11(16)12(15-14)10-6-8(13)3-4-9(7)10/h3-4,6-7H,2,5H2,1H3/p+1 |
| InChIKey | LZNVVBUQMNRTPO-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|