C11H14BrN — CID 22349548
5-bromo-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 22349548) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 5-bromo-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-bromo-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 22349548 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-bromo-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CN(C)C1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H14BrN/c1-13(2)11-6-3-8-7-9(12)4-5-10(8)11/h4-5,7,11H,3,6H2,1-2H3 |
| InChIKey | DSLBGMQJACDNKW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |