C18H14N2O3 — CID 170512672
2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)-1H-quinolin-4-one (PubChem CID 170512672) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)-1H-quinolin-4-one.
| Compound Name | 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 170512672 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)-1H-quinolin-4-one |
| SMILES | O=C1CC(c2cc(=O)c3ccccc3[nH]2)c2ccc(O)cc2N1 |
| InChI | InChI=1S/C18H14N2O3/c21-10-5-6-11-13(8-18(23)20-15(11)7-10)16-9-17(22)12-3-1-2-4-14(12)19-16/h1-7,9,13,21H,8H2,(H,19,22)(H,20,23) |
| InChIKey | KZWOPBPFLLSYRQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |