C15H11NO2 — CID 90719837
8-oxa-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-one (PubChem CID 90719837) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-oxa-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-one.
| Compound Name | 8-oxa-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-one |
|---|---|
| PubChem CID | 90719837 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 8-oxa-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-one |
| SMILES | O=C1CC2c3ccccc3Oc3cccc(c32)N1 |
| InChI | InChI=1S/C15H11NO2/c17-14-8-10-9-4-1-2-6-12(9)18-13-7-3-5-11(16-14)15(10)13/h1-7,10H,8H2,(H,16,17) |
| InChIKey | ZYKJKDFNBLRGEY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |