C21H22N2O3 — CID 50958678
7-(2-methoxyethoxy)-4-(3-methyl-1H-indol-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 50958678) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-4-(3-methyl-1H-indol-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(2-methoxyethoxy)-4-(3-methyl-1H-indol-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 50958678 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 7-(2-methoxyethoxy)-4-(3-methyl-1H-indol-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COCCOc1ccc2c(c1)NC(=O)CC2c1[nH]c2ccccc2c1C |
| InChI | InChI=1S/C21H22N2O3/c1-13-15-5-3-4-6-18(15)23-21(13)17-12-20(24)22-19-11-14(7-8-16(17)19)26-10-9-25-2/h3-8,11,17,23H,9-10,12H2,1-2H3,(H,22,24) |
| InChIKey | WSFKDWLOZLTGSH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|