C20H18N2O3S — CID 169417340
7-(2-phenoxyethoxy)-4-(1,3-thiazol-5-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 169417340) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 7-(2-phenoxyethoxy)-4-(1,3-thiazol-5-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(2-phenoxyethoxy)-4-(1,3-thiazol-5-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169417340 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 7-(2-phenoxyethoxy)-4-(1,3-thiazol-5-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(c2cncs2)c2ccc(OCCOc3ccccc3)cc2N1 |
| InChI | InChI=1S/C20H18N2O3S/c23-20-11-17(19-12-21-13-26-19)16-7-6-15(10-18(16)22-20)25-9-8-24-14-4-2-1-3-5-14/h1-7,10,12-13,17H,8-9,11H2,(H,22,23) |
| InChIKey | NNNYWJWJUIKFTR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|