C14H18BBr3ClNO2 — CID 157286478
7-(4-chlorobutoxy)-4-methyl-3,4-dihydro-1H-quinolin-2-one;tribromoborane (PubChem CID 157286478) has the molecular formula C14H18BBr3ClNO2 and a molecular weight of 518.28 g/mol. Its IUPAC name is 7-(4-chlorobutoxy)-4-methyl-3,4-dihydro-1H-quinolin-2-one;tribromoborane.
| Compound Name | 7-(4-chlorobutoxy)-4-methyl-3,4-dihydro-1H-quinolin-2-one;tribromoborane |
|---|---|
| PubChem CID | 157286478 |
| Molecular Formula | C14H18BBr3ClNO2 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 514.87 |
| IUPAC Name | 7-(4-chlorobutoxy)-4-methyl-3,4-dihydro-1H-quinolin-2-one;tribromoborane |
| SMILES | BrB(Br)Br.CC1CC(=O)Nc2cc(OCCCCCl)ccc21 |
| InChI | InChI=1S/C14H18ClNO2.BBr3/c1-10-8-14(17)16-13-9-11(4-5-12(10)13)18-7-3-2-6-15;2-1(3)4/h4-5,9-10H,2-3,6-8H2,1H3,(H,16,17); |
| InChIKey | BAHGWRNUBDHDBA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|