C14H17BrO3 — CID 155667336
7-(4-bromobutoxy)-4-methyl-3,4-dihydrochromen-2-one (PubChem CID 155667336) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is 7-(4-bromobutoxy)-4-methyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-(4-bromobutoxy)-4-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 155667336 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 7-(4-bromobutoxy)-4-methyl-3,4-dihydrochromen-2-one |
| SMILES | CC1CC(=O)Oc2cc(OCCCCBr)ccc21 |
| InChI | InChI=1S/C14H17BrO3/c1-10-8-14(16)18-13-9-11(4-5-12(10)13)17-7-3-2-6-15/h4-5,9-10H,2-3,6-8H2,1H3 |
| InChIKey | DTLGDWLXHKTDCZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|