C27H24O6 — CID 141283555
7-[[4-[(5-methoxy-1-benzofuran-2-yl)methoxy]phenyl]methoxy]-4-methyl-3,4-dihydrochromen-2-one (PubChem CID 141283555) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is 7-[[4-[(5-methoxy-1-benzofuran-2-yl)methoxy]phenyl]methoxy]-4-methyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-[[4-[(5-methoxy-1-benzofuran-2-yl)methoxy]phenyl]methoxy]-4-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141283555 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 7-[[4-[(5-methoxy-1-benzofuran-2-yl)methoxy]phenyl]methoxy]-4-methyl-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc2oc(COc3ccc(COc4ccc5c(c4)OC(=O)CC5C)cc3)cc2c1 |
| InChI | InChI=1S/C27H24O6/c1-17-11-27(28)33-26-14-22(7-9-24(17)26)30-15-18-3-5-20(6-4-18)31-16-23-13-19-12-21(29-2)8-10-25(19)32-23/h3-10,12-14,17H,11,15-16H2,1-2H3 |
| InChIKey | KFVHVJFMVWSLOW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|