C22H26O5 — CID 134834405
(4S)-4-(2,5-dipropoxyphenyl)-7-methoxy-3,4-dihydrochromen-2-one (PubChem CID 134834405) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4S)-4-(2,5-dipropoxyphenyl)-7-methoxy-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-4-(2,5-dipropoxyphenyl)-7-methoxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 134834405 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (4S)-4-(2,5-dipropoxyphenyl)-7-methoxy-3,4-dihydrochromen-2-one |
| SMILES | CCCOc1ccc(OCCC)c([C@H]2CC(=O)Oc3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C22H26O5/c1-4-10-25-16-7-9-20(26-11-5-2)19(12-16)18-14-22(23)27-21-13-15(24-3)6-8-17(18)21/h6-9,12-13,18H,4-5,10-11,14H2,1-3H3/t18-/m0/s1 |
| InChIKey | LUFIZONTSSTEJL-SFHVURJKSA-N |
| XLogP | 4.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|