C21H23NO6 — CID 20987087
2-[[4-[3-[2-(dimethylamino)ethoxy]phenyl]-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid (PubChem CID 20987087) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[[4-[3-[2-(dimethylamino)ethoxy]phenyl]-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid.
| Compound Name | 2-[[4-[3-[2-(dimethylamino)ethoxy]phenyl]-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 20987087 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[[4-[3-[2-(dimethylamino)ethoxy]phenyl]-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
| SMILES | CN(C)CCOc1cccc(C2CC(=O)Oc3cc(OCC(=O)O)ccc32)c1 |
| InChI | InChI=1S/C21H23NO6/c1-22(2)8-9-26-15-5-3-4-14(10-15)18-12-21(25)28-19-11-16(6-7-17(18)19)27-13-20(23)24/h3-7,10-11,18H,8-9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | CPDXQOVANKUNQL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|