C29H29N3O3S — CID 57335013
7-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]-4-phenyl-3,4-dihydrochromen-2-one (PubChem CID 57335013) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 7-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]-4-phenyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]-4-phenyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 57335013 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 7-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]-4-phenyl-3,4-dihydrochromen-2-one |
| SMILES | O=C1CC(c2ccccc2)c2ccc(OCCCN3CCN(c4nsc5ccccc45)CC3)cc2O1 |
| InChI | InChI=1S/C29H29N3O3S/c33-28-20-25(21-7-2-1-3-8-21)23-12-11-22(19-26(23)35-28)34-18-6-13-31-14-16-32(17-15-31)29-24-9-4-5-10-27(24)36-30-29/h1-5,7-12,19,25H,6,13-18,20H2 |
| InChIKey | XUOFYMGOCSARQB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|