C23H31N5OS — CID 19978345
3-[4-[4-(4,4a,5,6,7,8-hexahydrocinnolin-3-yloxy)butyl]piperazin-1-yl]-1,2-benzothiazole (PubChem CID 19978345) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is 3-[4-[4-(4,4a,5,6,7,8-hexahydrocinnolin-3-yloxy)butyl]piperazin-1-yl]-1,2-benzothiazole.
| Compound Name | 3-[4-[4-(4,4a,5,6,7,8-hexahydrocinnolin-3-yloxy)butyl]piperazin-1-yl]-1,2-benzothiazole |
|---|---|
| PubChem CID | 19978345 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-[4-[4-(4,4a,5,6,7,8-hexahydrocinnolin-3-yloxy)butyl]piperazin-1-yl]-1,2-benzothiazole |
| SMILES | c1ccc2c(N3CCN(CCCCOC4=NN=C5CCCCC5C4)CC3)nsc2c1 |
| InChI | InChI=1S/C23H31N5OS/c1-3-9-20-18(7-1)17-22(25-24-20)29-16-6-5-11-27-12-14-28(15-13-27)23-19-8-2-4-10-21(19)30-26-23/h2,4,8,10,18H,1,3,5-7,9,11-17H2 |
| InChIKey | RZBVUMJOAMETOZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|