C27H26N4O2S — CID 122196374
2-[4-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]phenyl]-1,3-benzoxazole (PubChem CID 122196374) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is 2-[4-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 122196374 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[4-[3-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]propoxy]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(OCCCN4CCN(c5nsc6ccccc56)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C27H26N4O2S/c1-4-9-25-22(6-1)26(29-34-25)31-17-15-30(16-18-31)14-5-19-32-21-12-10-20(11-13-21)27-28-23-7-2-3-8-24(23)33-27/h1-4,6-13H,5,14-19H2 |
| InChIKey | OTHIKKZLZJYTPI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|