C17H16N2O4 — CID 24772014
4-[4-(1,3-benzoxazol-2-yl)phenoxy]-N-hydroxybutanamide (PubChem CID 24772014) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-[4-(1,3-benzoxazol-2-yl)phenoxy]-N-hydroxybutanamide.
| Compound Name | 4-[4-(1,3-benzoxazol-2-yl)phenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 24772014 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-[4-(1,3-benzoxazol-2-yl)phenoxy]-N-hydroxybutanamide |
| SMILES | O=C(CCCOc1ccc(-c2nc3ccccc3o2)cc1)NO |
| InChI | InChI=1S/C17H16N2O4/c20-16(19-21)6-3-11-22-13-9-7-12(8-10-13)17-18-14-4-1-2-5-15(14)23-17/h1-2,4-5,7-10,21H,3,6,11H2,(H,19,20) |
| InChIKey | YHGJSFMAPSILHM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|