C29H31NO6 — CID 11755280
2,2-dimethylpropanoyloxymethyl 6-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate (PubChem CID 11755280) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 6-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 6-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 11755280 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 6-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CCCCCOc1ccc2cc(-c3nc4ccccc4o3)ccc2c1 |
| InChI | InChI=1S/C29H31NO6/c1-29(2,3)28(32)35-19-34-26(31)11-5-4-8-16-33-23-15-14-20-17-22(13-12-21(20)18-23)27-30-24-9-6-7-10-25(24)36-27/h6-7,9-10,12-15,17-18H,4-5,8,11,16,19H2,1-3H3 |
| InChIKey | LUAMDTMZJGJTRH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|