C19H17N5O3 — CID 171343292
4-[[3-(1,3-benzoxazol-2-yl)quinoxalin-2-yl]amino]-N-hydroxybutanamide (PubChem CID 171343292) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 4-[[3-(1,3-benzoxazol-2-yl)quinoxalin-2-yl]amino]-N-hydroxybutanamide.
| Compound Name | 4-[[3-(1,3-benzoxazol-2-yl)quinoxalin-2-yl]amino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 171343292 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-[[3-(1,3-benzoxazol-2-yl)quinoxalin-2-yl]amino]-N-hydroxybutanamide |
| SMILES | O=C(CCCNc1nc2ccccc2nc1-c1nc2ccccc2o1)NO |
| InChI | InChI=1S/C19H17N5O3/c25-16(24-26)10-5-11-20-18-17(21-12-6-1-2-7-13(12)22-18)19-23-14-8-3-4-9-15(14)27-19/h1-4,6-9,26H,5,10-11H2,(H,20,22)(H,24,25) |
| InChIKey | WSWHWICXPSMQTC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|