C21H25NO5 — CID 20984977
4-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-7-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 20984977) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-7-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | 4-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-7-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 20984977 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-7-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | CCOc1cc(C2CC(=O)Oc3cc(O)ccc32)ccc1OCCN(C)C |
| InChI | InChI=1S/C21H25NO5/c1-4-25-20-11-14(5-8-18(20)26-10-9-22(2)3)17-13-21(24)27-19-12-15(23)6-7-16(17)19/h5-8,11-12,17,23H,4,9-10,13H2,1-3H3 |
| InChIKey | CJNGAABQLCHHKN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|