C21H22O6 — CID 22688080
2-[[4-(4-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]-3-methylbutanoic acid (PubChem CID 22688080) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]-3-methylbutanoic acid.
| Compound Name | 2-[[4-(4-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22688080 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]-3-methylbutanoic acid |
| SMILES | COc1ccc(C2CC(=O)Oc3cc(OC(C(=O)O)C(C)C)ccc32)cc1 |
| InChI | InChI=1S/C21H22O6/c1-12(2)20(21(23)24)26-15-8-9-16-17(11-19(22)27-18(16)10-15)13-4-6-14(25-3)7-5-13/h4-10,12,17,20H,11H2,1-3H3,(H,23,24) |
| InChIKey | GOAGKFTYVUXDLF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|