C16H20O3 — CID 54481055
4-(cyclohepten-1-yl)-6,7,8,8a-tetrahydro-5H-cyclohepta[c]furan-1,3-dione (PubChem CID 54481055) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-(cyclohepten-1-yl)-6,7,8,8a-tetrahydro-5H-cyclohepta[c]furan-1,3-dione.
| Compound Name | 4-(cyclohepten-1-yl)-6,7,8,8a-tetrahydro-5H-cyclohepta[c]furan-1,3-dione |
|---|---|
| PubChem CID | 54481055 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-(cyclohepten-1-yl)-6,7,8,8a-tetrahydro-5H-cyclohepta[c]furan-1,3-dione |
| SMILES | O=C1OC(=O)C2CCCCC(C3=CCCCCC3)=C12 |
| InChI | InChI=1S/C16H20O3/c17-15-13-10-6-5-9-12(14(13)16(18)19-15)11-7-3-1-2-4-8-11/h7,13H,1-6,8-10H2 |
| InChIKey | XPABRSUPYSFYAH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|