C16H29N — CID 142404527
(3aE,11Z)-5-methyl-2,3,5,6,7,8,9,10-octahydro-1H-cyclopenta[10]annulen-4-amine;ethane (PubChem CID 142404527) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3aE,11Z)-5-methyl-2,3,5,6,7,8,9,10-octahydro-1H-cyclopenta[10]annulen-4-amine;ethane.
| Compound Name | (3aE,11Z)-5-methyl-2,3,5,6,7,8,9,10-octahydro-1H-cyclopenta[10]annulen-4-amine;ethane |
|---|---|
| PubChem CID | 142404527 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3aE,11Z)-5-methyl-2,3,5,6,7,8,9,10-octahydro-1H-cyclopenta[10]annulen-4-amine;ethane |
| SMILES | CC.CC1CCCCC/C=C2/CCC/C2=C/1N |
| InChI | InChI=1S/C14H23N.C2H6/c1-11-7-4-2-3-5-8-12-9-6-10-13(12)14(11)15;1-2/h8,11H,2-7,9-10,15H2,1H3;1-2H3/b12-8-,14-13+; |
| InChIKey | YCRIRVMKPCSQNT-NHAPUDJTSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |