C18H26O4 — CID 22639875
(2Z)-3-[(1E)-cycloocten-1-yl]cyclooct-2-ene-1,2-dicarboxylic acid (PubChem CID 22639875) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2Z)-3-[(1E)-cycloocten-1-yl]cyclooct-2-ene-1,2-dicarboxylic acid.
| Compound Name | (2Z)-3-[(1E)-cycloocten-1-yl]cyclooct-2-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22639875 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2Z)-3-[(1E)-cycloocten-1-yl]cyclooct-2-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)/C1=C(C2=C\CCCCCC\2)/CCCCCC1C(=O)O |
| InChI | InChI=1S/C18H26O4/c19-17(20)15-12-8-4-7-11-14(16(15)18(21)22)13-9-5-2-1-3-6-10-13/h9,15H,1-8,10-12H2,(H,19,20)(H,21,22)/b13-9+,16-14- |
| InChIKey | WOOCYHCHKGENIL-RHOXIIILSA-N |
| XLogP | 4.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |