About (1Z)-cyclooctene-1,2,3-tricarboxylic acid
(1Z)-cyclooctene-1,2,3-tricarboxylic acid (PubChem CID 121331499) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is (1Z)-cyclooctene-1,2,3-tricarboxylic acid.
Molecular Properties
| Compound Name | (1Z)-cyclooctene-1,2,3-tricarboxylic acid |
| PubChem CID | 121331499 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (1Z)-cyclooctene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)/C1=C(\C(=O)O)C(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C11H14O6/c12-9(13)6-4-2-1-3-5-7(10(14)15)8(6)11(16)17/h6H,1-5H2,(H,12,13)(H,14,15)(H,16,17)/b8-7- |
| InChIKey | MVIMZTTYIFTWGG-FPLPWBNLSA-N |
| XLogP | 1.12 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1Z)-cyclooctene-1,2,3-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-cyclooctene-1,2,3-tricarboxylic acid?
The IUPAC name of (1Z)-cyclooctene-1,2,3-tricarboxylic acid (CID 121331499) is (1Z)-cyclooctene-1,2,3-tricarboxylic acid.
What is the SMILES notation for (1Z)-cyclooctene-1,2,3-tricarboxylic acid?
The canonical SMILES for (1Z)-cyclooctene-1,2,3-tricarboxylic acid is O=C(O)/C1=C(\C(=O)O)C(C(=O)O)CCCCC1.
What is the InChIKey of (1Z)-cyclooctene-1,2,3-tricarboxylic acid?
The InChIKey is MVIMZTTYIFTWGG-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H14O6/c12-9(13)6-4-2-1-3-5-7(10(14)15)8(6)11(16)17/h6H,1-5H2,(H,12,13)(H,14,15)(H,16,17)/b8-7-.
What are the key properties of (1Z)-cyclooctene-1,2,3-tricarboxylic acid?
(1Z)-cyclooctene-1,2,3-tricarboxylic acid has a molecular weight of 242.23 g/mol, XLogP of 1.12, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-cyclooctene-1,2,3-tricarboxylic acid is sourced from PubChem (CID 121331499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).