C12H22 — CID 178125074
(1Z,6R,8S)-8-ethyl-1,6-dimethylcyclooctene (PubChem CID 178125074) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (1Z,6R,8S)-8-ethyl-1,6-dimethylcyclooctene.
| Compound Name | (1Z,6R,8S)-8-ethyl-1,6-dimethylcyclooctene |
|---|---|
| PubChem CID | 178125074 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (1Z,6R,8S)-8-ethyl-1,6-dimethylcyclooctene |
| SMILES | CC[C@H]1C[C@H](C)CCC/C=C\1C |
| InChI | InChI=1S/C12H22/c1-4-12-9-10(2)7-5-6-8-11(12)3/h8,10,12H,4-7,9H2,1-3H3/b11-8-/t10-,12+/m1/s1 |
| InChIKey | AFDFACIZMSCDPR-RWPCGZBTSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|