C17H26OSi — CID 15526603
2,5-dimethyl-1-(3-methylbut-1-en-2-yloxy)-1-phenylsilolane (PubChem CID 15526603) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-methylbut-1-en-2-yloxy)-1-phenylsilolane.
| Compound Name | 2,5-dimethyl-1-(3-methylbut-1-en-2-yloxy)-1-phenylsilolane |
|---|---|
| PubChem CID | 15526603 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,5-dimethyl-1-(3-methylbut-1-en-2-yloxy)-1-phenylsilolane |
| SMILES | C=C(O[Si]1(c2ccccc2)C(C)CCC1C)C(C)C |
| InChI | InChI=1S/C17H26OSi/c1-13(2)16(5)18-19(14(3)11-12-15(19)4)17-9-7-6-8-10-17/h6-10,13-15H,5,11-12H2,1-4H3 |
| InChIKey | DKRSORQPWROIHS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|