About ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane
ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 143093806) has the molecular formula C22H38O
and a molecular weight of 318.55 g/mol. Its IUPAC name is ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane |
| PubChem CID | 143093806 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | C=C(O)c1ccccc1CC.CC.CC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C10H12O.C10H20.C2H6/c1-3-9-6-4-5-7-10(9)8(2)11;1-8(2)10-6-4-9(3)5-7-10;1-2/h4-7,11H,2-3H2,1H3;8-10H,4-7H2,1-3H3;1-2H3 |
| InChIKey | WDTPOLDCFQRWMW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane?
The IUPAC name of ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane (CID 143093806) is ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane.
What is the SMILES notation for ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane?
The canonical SMILES for ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane is C=C(O)c1ccccc1CC.CC.CC1CCC(C(C)C)CC1.
What is the InChIKey of ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane?
The InChIKey is WDTPOLDCFQRWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C10H20.C2H6/c1-3-9-6-4-5-7-10(9)8(2)11;1-8(2)10-6-4-9(3)5-7-10;1-2/h4-7,11H,2-3H2,1H3;8-10H,4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane?
ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane has a molecular weight of 318.55 g/mol, XLogP of 7.27, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-ethylphenyl)ethenol;1-methyl-4-propan-2-ylcyclohexane is sourced from PubChem (CID 143093806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).