C22H21ClOSi — CID 122390730
(3R,5S)-5-(3-chlorophenyl)-3-methyl-2,2-diphenyloxasilolane (PubChem CID 122390730) has the molecular formula C22H21ClOSi and a molecular weight of 364.95 g/mol. Its IUPAC name is (3R,5S)-5-(3-chlorophenyl)-3-methyl-2,2-diphenyloxasilolane.
| Compound Name | (3R,5S)-5-(3-chlorophenyl)-3-methyl-2,2-diphenyloxasilolane |
|---|---|
| PubChem CID | 122390730 |
| Molecular Formula | C22H21ClOSi |
| Molecular Weight | 364.95 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (3R,5S)-5-(3-chlorophenyl)-3-methyl-2,2-diphenyloxasilolane |
| SMILES | C[C@@H]1C[C@@H](c2cccc(Cl)c2)O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21ClOSi/c1-17-15-22(18-9-8-10-19(23)16-18)24-25(17,20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-14,16-17,22H,15H2,1H3/t17-,22+/m1/s1 |
| InChIKey | IKTOPMWBZXNLBV-VGSWGCGISA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|