C17H23ClF2Si — CID 139792190
1-chloro-4-(4,4-difluorocyclohexyl)-1-phenylsilinane (PubChem CID 139792190) has the molecular formula C17H23ClF2Si and a molecular weight of 328.91 g/mol. Its IUPAC name is 1-chloro-4-(4,4-difluorocyclohexyl)-1-phenylsilinane.
| Compound Name | 1-chloro-4-(4,4-difluorocyclohexyl)-1-phenylsilinane |
|---|---|
| PubChem CID | 139792190 |
| Molecular Formula | C17H23ClF2Si |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-chloro-4-(4,4-difluorocyclohexyl)-1-phenylsilinane |
| SMILES | FC1(F)CCC(C2CC[Si](Cl)(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C17H23ClF2Si/c18-21(16-4-2-1-3-5-16)12-8-15(9-13-21)14-6-10-17(19,20)11-7-14/h1-5,14-15H,6-13H2 |
| InChIKey | MODXVBPTDIUHJO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|